2,2,4-trimethylchromen-6-ol
2,2,4-trimethylchromen-6-ol structure
|
Common Name | 2,2,4-trimethylchromen-6-ol | ||
|---|---|---|---|---|
| CAS Number | 5331-20-4 | Molecular Weight | 190.23800 | |
| Density | 1.084g/cm3 | Boiling Point | 317.2ºC at 760 mmHg | |
| Molecular Formula | C12H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.2ºC | |
Summary: 2,2,4-Trimethylchromen-6-ol (Chinese name: 2,2,4-三甲基色原酮, CAS number: 5331-20-4), molecular formula C12H14O2, molecular weight 190.23800. The boiling point is 317.2ºC at 760 mmHg, and the density is 1.084 g/cm³. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2,4-trimethylchromen-6-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.084g/cm3 |
|---|---|
| Boiling Point | 317.2ºC at 760 mmHg |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.23800 |
| Flash Point | 140.2ºC |
| Exact Mass | 190.09900 |
| PSA | 29.46000 |
| LogP | 2.96650 |
| Index of Refraction | 1.545 |
| InChIKey | WMPVYVYQUPPSNJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(C)(C)Oc2ccc(O)cc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,2,4-trimethyl... CAS#:5331-20-4 |
| Literature: Bergel et al. Journal of the Chemical Society, 1938 , p. 1375,1380 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,2,4-trimethyl-2H-chromen-6-ol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2,2,4-trimethylchromen-6-ol? |
| A: Polar surface area (PSA) of 2,2,4-trimethylchromen-6-ol is 29.46000. |
| Q: What is the InChIKey of 2,2,4-trimethylchromen-6-ol? |
| A: InChIKey of 2,2,4-trimethylchromen-6-ol is WMPVYVYQUPPSNJ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,2,4-trimethylchromen-6-ol? |
| A: Molecular formula of 2,2,4-trimethylchromen-6-ol is C12H14O2. |
| Q: What is the molecular weight of 2,2,4-trimethylchromen-6-ol? |
| A: Molecular weight of 2,2,4-trimethylchromen-6-ol is 190.23800. |
| Q: What is the boiling point of 2,2,4-trimethylchromen-6-ol? |
| A: Boiling point of 2,2,4-trimethylchromen-6-ol is 317.2ºC at 760 mmHg. |
| Q: What is the LogP of 2,2,4-trimethylchromen-6-ol? |
| A: LogP of 2,2,4-trimethylchromen-6-ol is 2.96650. |
| Q: What is the CAS number of 2,2,4-trimethylchromen-6-ol? |
| A: CAS number of 2,2,4-trimethylchromen-6-ol is 5331-20-4. |
| Q: What English synonyms does 2,2,4-trimethylchromen-6-ol have? |
| A: English synonyms of 2,2,4-trimethylchromen-6-ol: 2,2,4-trimethyl-2H-chromen-6-ol. |
| Q: What is the Chinese name of 5331-20-4? |
| A: Chinese name of 5331-20-4 is 5331-20-4. |
| Q: What is the English name of 2,2,4-trimethylchromen-6-ol? |
| A: The English name of 2,2,4-trimethylchromen-6-ol is 2,2,4-trimethylchromen-6-ol. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |