2,2,4-trimethylchromen-6-ol structure
|
Common Name | 2,2,4-trimethylchromen-6-ol | ||
|---|---|---|---|---|
| CAS Number | 5331-20-4 | Molecular Weight | 190.23800 | |
| Density | 1.084g/cm3 | Boiling Point | 317.2ºC at 760 mmHg | |
| Molecular Formula | C12H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.2ºC | |
| Name | 2,2,4-trimethylchromen-6-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.084g/cm3 |
|---|---|
| Boiling Point | 317.2ºC at 760 mmHg |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.23800 |
| Flash Point | 140.2ºC |
| Exact Mass | 190.09900 |
| PSA | 29.46000 |
| LogP | 2.96650 |
| Index of Refraction | 1.545 |
| InChIKey | WMPVYVYQUPPSNJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(C)(C)Oc2ccc(O)cc21 |
|
~%
2,2,4-trimethyl... CAS#:5331-20-4 |
| Literature: Bergel et al. Journal of the Chemical Society, 1938 , p. 1375,1380 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,2,4-trimethyl-2H-chromen-6-ol |