Benzene,1-(1,1-dimethylethyl)-4-phenoxy structure
|
Common Name | Benzene,1-(1,1-dimethylethyl)-4-phenoxy | ||
|---|---|---|---|---|
| CAS Number | 5331-28-2 | Molecular Weight | 226.31400 | |
| Density | 0.998g/cm3 | Boiling Point | 307.1ºC at 760mmHg | |
| Molecular Formula | C16H18O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.1ºC | |
| Name | 1-tert-butyl-4-phenoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.998g/cm3 |
|---|---|
| Boiling Point | 307.1ºC at 760mmHg |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.31400 |
| Flash Point | 135.1ºC |
| Exact Mass | 226.13600 |
| PSA | 9.23000 |
| LogP | 4.77640 |
| Index of Refraction | 1.539 |
| InChIKey | REZBJCUQELMZBL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(Oc2ccccc2)cc1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-t-butylphenyl phenyl ether |
| Benzene,1-dimethylethyl)-4-phenoxy |
| 4-tert-Butyldiphenyl ether |
| 4-Phenoxy-tert-butylbenzene |