Benzene,1-(1,1-dimethylethyl)-4-phenoxy
Benzene,1-(1,1-dimethylethyl)-4-phenoxy structure
|
Common Name | Benzene,1-(1,1-dimethylethyl)-4-phenoxy | ||
|---|---|---|---|---|
| CAS Number | 5331-28-2 | Molecular Weight | 226.31400 | |
| Density | 0.998g/cm3 | Boiling Point | 307.1ºC at 760mmHg | |
| Molecular Formula | C16H18O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-tert-butyl-4-phenoxybenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.998g/cm3 |
|---|---|
| Boiling Point | 307.1ºC at 760mmHg |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.31400 |
| Flash Point | 135.1ºC |
| Exact Mass | 226.13600 |
| PSA | 9.23000 |
| LogP | 4.77640 |
| Index of Refraction | 1.539 |
| InChIKey | REZBJCUQELMZBL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(Oc2ccccc2)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2909309090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-t-butylphenyl phenyl ether |
| Benzene,1-dimethylethyl)-4-phenoxy |
| 4-tert-Butyldiphenyl ether |
| 4-Phenoxy-tert-butylbenzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-tert-butyl-4-phenoxybenzene? |
| A: CAS number of 1-tert-butyl-4-phenoxybenzene is 5331-28-2. |
| Q: What is the SMILES notation of 1-tert-butyl-4-phenoxybenzene? |
| A: SMILES notation of 1-tert-butyl-4-phenoxybenzene is CC(C)(C)c1ccc(Oc2ccccc2)cc1. |
| Q: What is the InChIKey of 1-tert-butyl-4-phenoxybenzene? |
| A: InChIKey of 1-tert-butyl-4-phenoxybenzene is REZBJCUQELMZBL-UHFFFAOYSA-N. |
| Q: What is the boiling point of 1-tert-butyl-4-phenoxybenzene? |
| A: Boiling point of 1-tert-butyl-4-phenoxybenzene is 307.1ºC at 760mmHg. |
| Q: What is the English name of 1-tert-butyl-4-phenoxybenzene? |
| A: The English name of 1-tert-butyl-4-phenoxybenzene is 1-tert-butyl-4-phenoxybenzene. |
| Q: What is the LogP of 1-tert-butyl-4-phenoxybenzene? |
| A: LogP of 1-tert-butyl-4-phenoxybenzene is 4.77640. |
| Q: What English synonyms does 1-tert-butyl-4-phenoxybenzene have? |
| A: English synonyms of 1-tert-butyl-4-phenoxybenzene: 4-t-butylphenyl phenyl ether, Benzene,1-dimethylethyl)-4-phenoxy, 4-tert-Butyldiphenyl ether, 4-Phenoxy-tert-butylbenzene. |
| Q: What is the polar surface area (PSA) of 1-tert-butyl-4-phenoxybenzene? |
| A: Polar surface area (PSA) of 1-tert-butyl-4-phenoxybenzene is 9.23000. |
| Q: What is the molecular formula of 1-tert-butyl-4-phenoxybenzene? |
| A: Molecular formula of 1-tert-butyl-4-phenoxybenzene is C16H18O. |
| Q: What is the molecular weight of 1-tert-butyl-4-phenoxybenzene? |
| A: Molecular weight of 1-tert-butyl-4-phenoxybenzene is 226.31400. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |