N-benzyl-1-(2-methoxyphenyl)-N-methyl-propan-2-amine structure
|
Common Name | N-benzyl-1-(2-methoxyphenyl)-N-methyl-propan-2-amine | ||
|---|---|---|---|---|
| CAS Number | 5331-86-2 | Molecular Weight | 305.84200 | |
| Density | 1.019g/cm3 | Boiling Point | 363.9ºC at 760 mmHg | |
| Molecular Formula | C18H24ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 107.4ºC | |
| Name | N-benzyl-1-(2-methoxyphenyl)-N-methylpropan-2-amine,hydrochloride |
|---|
| Density | 1.019g/cm3 |
|---|---|
| Boiling Point | 363.9ºC at 760 mmHg |
| Molecular Formula | C18H24ClNO |
| Molecular Weight | 305.84200 |
| Flash Point | 107.4ºC |
| Exact Mass | 305.15500 |
| PSA | 12.47000 |
| LogP | 4.56020 |
| Index of Refraction | 1.553 |
| InChIKey | DDAIBUOHECFCIH-UHFFFAOYSA-N |
| SMILES | COc1ccccc1CC(C)N(C)Cc1ccccc1.Cl |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |