[(2S,3R)-3-(acetyloxymethyl)norbornan-2-yl]methyl acetate structure
|
Common Name | [(2S,3R)-3-(acetyloxymethyl)norbornan-2-yl]methyl acetate | ||
|---|---|---|---|---|
| CAS Number | 5332-76-3 | Molecular Weight | 240.29500 | |
| Density | 1.09g/cm3 | Boiling Point | 300.6ºC at 760 mmHg | |
| Molecular Formula | C13H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.2ºC | |
| Name | [(2S,3R)-3-(acetyloxymethyl)-2-bicyclo[2.2.1]heptanyl]methyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 300.6ºC at 760 mmHg |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.29500 |
| Flash Point | 141.2ºC |
| Exact Mass | 240.13600 |
| PSA | 52.60000 |
| LogP | 1.77490 |
| Index of Refraction | 1.472 |
| InChIKey | DNBMMUAYISKAFV-BPNZPQAUSA-N |
| SMILES | CC(=O)OCC1C2CCC(C2)C1COC(C)=O |
|
~%
[(2S,3R)-3-(ace... CAS#:5332-76-3 |
| Literature: Alder; Roth Chemische Berichte, 1955 , vol. 88, p. 407,416 |
|
~%
[(2S,3R)-3-(ace... CAS#:5332-76-3 |
| Literature: Alder; Roth Chemische Berichte, 1955 , vol. 88, p. 407,416 |
|
~%
[(2S,3R)-3-(ace... CAS#:5332-76-3 |
| Literature: Bailey; Lawson Journal of the American Chemical Society, 1955 , vol. 77, p. 1606 |
| 2endo,3endo-Bis-acetoxymethyl-norbornan |
| (2r,3s)-bicyclo[2.2.1]heptane-2,3-diyldimethanediyl diacetate |
| 2endo,3endo-bis-acetoxymethyl-norbornane |
| bicyclo<2.2.1>heptane-endo-2,endo-3-dimethanol diacetate |