oxido-(4-phenylsulfanylphenyl)-(4-phenylsulfanylphenyl)imino-azanium structure
|
Common Name | oxido-(4-phenylsulfanylphenyl)-(4-phenylsulfanylphenyl)imino-azanium | ||
|---|---|---|---|---|
| CAS Number | 5333-73-3 | Molecular Weight | 414.54300 | |
| Density | 1.19g/cm3 | Boiling Point | 619.5ºC at 760 mmHg | |
| Molecular Formula | C24H18N2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328.5ºC | |
| Name | oxido-(4-phenylsulfanylphenyl)-(4-phenylsulfanylphenyl)iminoazanium |
|---|
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 619.5ºC at 760 mmHg |
| Molecular Formula | C24H18N2OS2 |
| Molecular Weight | 414.54300 |
| Flash Point | 328.5ºC |
| Exact Mass | 414.08600 |
| PSA | 91.71000 |
| LogP | 8.43790 |
| Index of Refraction | 1.65 |
| InChIKey | BMRCRKGXUGEOFS-UHFFFAOYSA-N |
| SMILES | [O-][N+](=Nc1ccc(Sc2ccccc2)cc1)c1ccc(Sc2ccccc2)cc1 |
| HS Code | 2930909090 |
|---|
|
~%
oxido-(4-phenyl... CAS#:5333-73-3 |
| Literature: Gandhi,S.S. et al. Journal of Organic Chemistry, 1979 , vol. 44, # 25 p. 4705 - 4707 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |