Carbamic acid,(2-chlorobutylidene)di-, diethyl ester (8CI) structure
|
Common Name | Carbamic acid,(2-chlorobutylidene)di-, diethyl ester (8CI) | ||
|---|---|---|---|---|
| CAS Number | 5336-12-9 | Molecular Weight | 266.72200 | |
| Density | 1.157g/cm3 | Boiling Point | 385.6ºC at 760 mmHg | |
| Molecular Formula | C10H19ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187ºC | |
| Name | (2-chlorobutylidene)dicarbamic acid, diethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.157g/cm3 |
|---|---|
| Boiling Point | 385.6ºC at 760 mmHg |
| Molecular Formula | C10H19ClN2O4 |
| Molecular Weight | 266.72200 |
| Flash Point | 187ºC |
| Exact Mass | 266.10300 |
| PSA | 76.66000 |
| LogP | 2.60390 |
| Index of Refraction | 1.466 |
| InChIKey | XHZPNWYHYACREP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC(NC(=O)OCC)C(Cl)CC |
| HS Code | 2924199090 |
|---|
|
~%
Carbamic acid,(... CAS#:5336-12-9 |
| Literature: Foglia,T.A.; Swern,D. Tetrahedron Letters, 1967 , p. 3963 - 3967 |
|
~%
Carbamic acid,(... CAS#:5336-12-9 |
| Literature: Krattiger Bulletin de la Societe Chimique de France, 1953 , p. 222,224 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(1-Chlor-propyl)-2,4-diaza-glutarsaeure-diaethylester |
| 1,1-Bis-(aethoxycarbonylamino)-2-chlor-butan |
| 3-(1-chloro-propyl)-2,4-diaza-glutaric acid diethyl ester |
| 3-(1-chloro-2-oxo-2-phenyl-ethyl)-1H-quinoxalin-2-one |
| 3-(1-chloro-2-oxo-2-phenylethyl)-2(1H)quinoxalinone |
| 2(1H)-Quinoxalinone,3-(1-chloro-2-oxo-2-phenylethyl) |