N-(6-chloro-2-methoxy-acridin-9-yl)-N,N-diethyl-propane-1,3-diamine
Modify Date: 2025-09-01 18:22:56
N-(6-chloro-2-methoxy-acridin-9-yl)-N,N-diethyl-propane-1,3-diamine structure
|
Common Name | N-(6-chloro-2-methoxy-acridin-9-yl)-N,N-diethyl-propane-1,3-diamine | ||
|---|---|---|---|---|
| CAS Number | 5336-65-2 | Molecular Weight | 408.36500 | |
| Density | 1.189g/cm3 | Boiling Point | 538.5ºC at 760 mmHg | |
| Molecular Formula | C21H27Cl2N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.5ºC | |
| Name | chloro-9-[[3-(diethylamino)propyl]amino]-2-methoxyacridine, dihydrochloride, dihydrate |
|---|
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 538.5ºC at 760 mmHg |
| Molecular Formula | C21H27Cl2N3O |
| Molecular Weight | 408.36500 |
| Flash Point | 279.5ºC |
| Exact Mass | 407.15300 |
| PSA | 37.39000 |
| LogP | 6.06880 |
| Index of Refraction | 1.64 |
| InChIKey | JQXKUFYMRDWBEU-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCNc1c2ccc(Cl)cc2nc2ccc(OC)cc12.Cl |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1