N-[4-[3-(4-diethylaminophenyl)prop-2-enoyl]phenyl]acetamide structure
|
Common Name | N-[4-[3-(4-diethylaminophenyl)prop-2-enoyl]phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 5336-81-2 | Molecular Weight | 336.42700 | |
| Density | 1.144g/cm3 | Boiling Point | 574.5ºC at 760 mmHg | |
| Molecular Formula | C21H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.3ºC | |
| Name | N-[4-[(Z)-3-[4-(diethylamino)phenyl]prop-2-enoyl]phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 574.5ºC at 760 mmHg |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.42700 |
| Flash Point | 301.3ºC |
| Exact Mass | 336.18400 |
| PSA | 49.41000 |
| LogP | 4.46030 |
| Index of Refraction | 1.632 |
| InChIKey | ONUKCIRBTIOCHE-NVNXTCNLSA-N |
| SMILES | CCN(CC)c1ccc(C=CC(=O)c2ccc(NC(C)=O)cc2)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
N-[4-[3-(4-diet... CAS#:5336-81-2 |
| Literature: Lutz et al. Journal of Organic Chemistry, 1949 , vol. 14, p. 982,994 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-diethylamino-4'-acetylamino-trans-chalcone |
| 3-Methyl-4-N-diethylamino-2-butanol |
| 1-Diethylamino-3-hydroxy-2-methylbutane |
| 4-Diaethylamino-4'-acetamino-trans-chalkon |
| 4-Diaethylamino-3-methyl-butan-2-ol |
| 4-diethylamino-3-methyl-butan-2-ol |