methyl (2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoate
Modify Date: 2026-07-13 18:22:15
amino}-4-methylpentanoate Structure](https://www.chemsrc.com/extcaspic/426/53363-90-9.png)
methyl (2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoate structure
|
Common Name | methyl (2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoate | ||
|---|---|---|---|---|
| CAS Number | 53363-90-9 | Molecular Weight | 259.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl (2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H25NO4 |
|---|---|
| Molecular Weight | 259.34 |
| InChIKey | XEYQMDIHLQBTQL-JTQLQIEISA-N |
| SMILES | COC(=O)C(CC(C)C)N(C)C(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 53363-90-9? |
| A: Chinese name of 53363-90-9 is 53363-90-9. |
| Q: What is the SMILES notation of methyl (2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoate? |
| A: SMILES notation of methyl (2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoate is COC(=O)C(CC(C)C)N(C)C(=O)OC(C)(C)C. |
| Q: What is the molecular weight of methyl (2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoate? |
| A: Molecular weight of methyl (2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoate is 259.34. |
| Q: What is the English name of methyl (2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoate? |
| A: The English name of methyl (2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoate is methyl (2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoate. |
| Q: What is the CAS number of methyl (2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoate? |
| A: CAS number of methyl (2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoate is 53363-90-9. |
| Q: What is the InChIKey of methyl (2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoate? |
| A: InChIKey of methyl (2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoate is XEYQMDIHLQBTQL-JTQLQIEISA-N. |
| Q: What is the molecular formula of methyl (2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoate? |
| A: Molecular formula of methyl (2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoate is C13H25NO4. |