(2E)-2-chloro-2-hydroxyimino-1-(4-phenylphenyl)ethanone structure
|
Common Name | (2E)-2-chloro-2-hydroxyimino-1-(4-phenylphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 5337-28-0 | Molecular Weight | 259.68800 | |
| Density | 1.239g/cm3 | Boiling Point | 453.951ºC at 760 mmHg | |
| Molecular Formula | C14H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.342ºC | |
| Name | (1Z)-N-hydroxy-2-oxo-2-(4-phenylphenyl)ethanimidoyl chloride |
|---|
| Density | 1.239g/cm3 |
|---|---|
| Boiling Point | 453.951ºC at 760 mmHg |
| Molecular Formula | C14H10ClNO2 |
| Molecular Weight | 259.68800 |
| Flash Point | 228.342ºC |
| Exact Mass | 259.04000 |
| PSA | 49.66000 |
| LogP | 3.56280 |
| Index of Refraction | 1.596 |
| InChIKey | GYDDEJWKTNOAOF-PEZBUJJGSA-N |
| SMILES | O=C(C(Cl)=NO)c1ccc(-c2ccccc2)cc1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |