(E)-1-(4-chlorophenyl)-3-pyridin-2-yl-prop-2-en-1-one structure
|
Common Name | (E)-1-(4-chlorophenyl)-3-pyridin-2-yl-prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 5337-52-0 | Molecular Weight | 243.68800 | |
| Density | 1.249g/cm3 | Boiling Point | 400.9ºC at 760 mmHg | |
| Molecular Formula | C14H10ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.3ºC | |
| Name | 4'-chloro-3-(2-pyridyl)acrylophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 400.9ºC at 760 mmHg |
| Molecular Formula | C14H10ClNO |
| Molecular Weight | 243.68800 |
| Flash Point | 196.3ºC |
| Exact Mass | 243.04500 |
| PSA | 29.96000 |
| LogP | 3.63110 |
| Index of Refraction | 1.638 |
| InChIKey | JNQTUTAQTWGYEM-CMDGGOBGSA-N |
| SMILES | O=C(C=Cc1ccccn1)c1ccc(Cl)cc1 |
|
~97%
(E)-1-(4-chloro... CAS#:5337-52-0 |
| Literature: Downs, Laura E.; Wolfe, Derek M.; Schreiner, Peter R. Advanced Synthesis and Catalysis, 2005 , vol. 347, # 2-3 p. 235 - 238 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(4-Chlorphenyl)-3-(2-pyridyl)-2-propen-1-on |
| 1-(4-chlorophenyl)-3-(2-pyridyl)propen-1-one |
| N-(3-pyridyl)-N'-(4-chlorophenyl)urea |
| 1-(4-chloro-phenyl)-3-pyridin-3-yl-urea |