4,4'-Benzyloxymethylenebis(N,N-dimethylbenzenamine) structure
|
Common Name | 4,4'-Benzyloxymethylenebis(N,N-dimethylbenzenamine) | ||
|---|---|---|---|---|
| CAS Number | 53370-57-3 | Molecular Weight | 360.49200 | |
| Density | 1.095g/cm3 | Boiling Point | 500.9ºC at 760mmHg | |
| Molecular Formula | C24H28N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.8ºC | |
| Name | 4-[[4-(dimethylamino)phenyl]-phenylmethoxymethyl]-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.095g/cm3 |
|---|---|
| Boiling Point | 500.9ºC at 760mmHg |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.49200 |
| Flash Point | 138.8ºC |
| Exact Mass | 360.22000 |
| PSA | 15.71000 |
| LogP | 5.12480 |
| InChIKey | YBOBZZSJMAWFBX-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(OCc2ccccc2)c2ccc(N(C)C)cc2)cc1 |
| HS Code | 2922199090 |
|---|
|
~%
4,4'-Benzyloxym... CAS#:53370-57-3 |
| Literature: Fischer,O.; Weiss Ztschr. f. Farben- u. Textilchemie, vol. 1, p. 2 Chem. Zentralbl., 1902 , vol. 73, # I p. 471 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4,4'-[(benzyloxy)methanediyl]bis(N,N-dimethylaniline) |
| 4,4'-((Phenylmethoxy)methylene)bis(N,N'-dimethylbenzenamine) |
| 4,4'-[(benzyloxy)methylene]bis(n,n-dimethylaniline) |
| benzyloxy-bis-(4-dimethylamino-phenyl)-methane |
| 4.4'-Bis-dimethylamino-benzhydrol-benzylaether |