phenyl N-acetamido-N-benzylcarbamate structure
|
Common Name | phenyl N-acetamido-N-benzylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 53370-82-4 | Molecular Weight | 284.31000 | |
| Density | 1.215g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenyl N-acetamido-N-benzylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.215g/cm3 |
|---|---|
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31000 |
| Exact Mass | 284.11600 |
| PSA | 62.13000 |
| LogP | 3.57900 |
| Index of Refraction | 1.587 |
| InChIKey | PFQYPDARZRQFGF-UHFFFAOYSA-N |
| SMILES | CC(=O)NN(Cc1ccccc1)C(=O)Oc1ccccc1 |
| HS Code | 2928000090 |
|---|
|
~%
phenyl N-acetam... CAS#:53370-82-4 |
| Literature: Gray,C.J. et al. Tetrahedron, 1977 , vol. 33, p. 739 - 743 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| phenyl 2-acetyl-1-benzylhydrazinecarboxylate |
| Phenyl N(2)-acetyl-N-benzylcarbazate |