4-Pyrimidinesulfonamide,1,2,3,6-tetrahydro-2,6-dioxo
Modify Date: 2025-09-28 10:36:36
4-Pyrimidinesulfonamide,1,2,3,6-tetrahydro-2,6-dioxo structure
|
Common Name | 4-Pyrimidinesulfonamide,1,2,3,6-tetrahydro-2,6-dioxo | ||
|---|---|---|---|---|
| CAS Number | 5338-86-3 | Molecular Weight | 191.16500 | |
| Density | 1.85g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C4H5N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-dioxo-1H-pyrimidine-6-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.85g/cm3 |
|---|---|
| Molecular Formula | C4H5N3O4S |
| Molecular Weight | 191.16500 |
| Exact Mass | 191.00000 |
| PSA | 134.26000 |
| Index of Refraction | 1.661 |
| InChIKey | UGTUDBJNUBFRBX-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1cc(=O)[nH]c(=O)[nH]1 |
| HS Code | 2935009090 |
|---|
|
~%
4-Pyrimidinesul... CAS#:5338-86-3 |
| Literature: Greenbaum Journal of the American Chemical Society, 1954 , vol. 76, p. 6052 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 3, Current Page 1 of 1
1
| 6-Uracilsulfonamide |
| Uracil-6-sulfonamide |
| 2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-sulfonamide |
| 2,6-dioxo-1,2,3,4-tetrahydro-pyrimidine-4-sulfonic acid amide |
| Uracil-6-sulfamid |
| 2,6-Dioxo-1,2,3,6-tetrahydro-pyrimidin-4-sulfonsaeure-amid |
| 2,6-Dihydroxy-4-pyrimidinesulfonamide |
| 2,6-dioxo-1,2,3,6-tetrahydro-pyrimidine-4-sulfonic acid amide |