N-[2-(4-nitrophenyl)ethyl]cyclohexanamine structure
|
Common Name | N-[2-(4-nitrophenyl)ethyl]cyclohexanamine | ||
|---|---|---|---|---|
| CAS Number | 5338-99-8 | Molecular Weight | 248.32100 | |
| Density | 1.11g/cm3 | Boiling Point | 399.5ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.4ºC | |
| Name | N-[2-(4-nitrophenyl)ethyl]cyclohexanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 399.5ºC at 760 mmHg |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.32100 |
| Flash Point | 195.4ºC |
| Exact Mass | 248.15200 |
| PSA | 57.85000 |
| LogP | 3.97370 |
| Index of Refraction | 1.554 |
| InChIKey | PQZWWEGKFMAJDD-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CCNC2CCCCC2)cc1 |
| HS Code | 2921300090 |
|---|
|
~%
N-[2-(4-nitroph... CAS#:5338-99-8 |
| Literature: Liu, Hong; Ji, Ming; Luo, Xiaomin; Shen, Jianhua; Huang, Xiaoqin; Hua, Weiyi; Jiang, Hualiang; Chen, Kaixian Journal of Medicinal Chemistry, 2002 , vol. 45, # 14 p. 2953 - 2969 |
|
~%
N-[2-(4-nitroph... CAS#:5338-99-8 |
| Literature: Liu, Hong; Ji, Ming; Luo, Xiaomin; Shen, Jianhua; Huang, Xiaoqin; Hua, Weiyi; Jiang, Hualiang; Chen, Kaixian Journal of Medicinal Chemistry, 2002 , vol. 45, # 14 p. 2953 - 2969 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921300090 |
|---|---|
| Summary | 2921300090 other cyclanic, cyclenic or cyclotherpenic mono- or polyamines, and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| cyclohexyl-(4-nitro-phenethyl)-amine |
| N-(cyclohexyl)-p-nitrophenethylamine |
| Cyclohexyl-(4-nitro-phenaethyl)-amin |
| benzeneethanamine,n-cyclohexyl-4-nitro |