N-butyl-N-[2-(4-nitrophenyl)ethyl]butan-1-amine structure
|
Common Name | N-butyl-N-[2-(4-nitrophenyl)ethyl]butan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 5339-00-4 | Molecular Weight | 278.39000 | |
| Density | 1.018g/cm3 | Boiling Point | 391ºC at 760 mmHg | |
| Molecular Formula | C16H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.3ºC | |
| Name | 2,4-Dichlor-6--s-triazin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.018g/cm3 |
|---|---|
| Boiling Point | 391ºC at 760 mmHg |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.39000 |
| Flash Point | 190.3ºC |
| Exact Mass | 278.19900 |
| PSA | 49.06000 |
| LogP | 4.56270 |
| Index of Refraction | 1.52 |
| InChIKey | BDYHHTQXTLRPRK-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)CCc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2921199090 |
|---|
| HS Code | 2921199090 |
|---|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| dibutyl-(4-nitro-phenethyl)-amine |
| dibutyl-(dichloro-[1,3,5]triazin-2-yl)-amine |
| 2,4-Dichloro-6-di-n-butylamino-s-triazin |
| 1,3,5-Triazin-2-amine,N,N-dibutyl-4,6-dichloro |
| dibutyl-(4,6-dichloro-[1,3,5]triazin-2-yl)-amine |
| 2-(N,N-dibutylamino)-4,6-dichloro-1,3,5-triazine |
| Dibutyl-(4-nitro-phenaethyl)-amin |
| Dibutyl-(dichlor-[1,3,5]triazin-2-yl)-amin |