N-benzyl-2-(2-nitrophenyl)ethanamine
Modify Date: 2025-09-19 10:01:02
N-benzyl-2-(2-nitrophenyl)ethanamine structure
|
Common Name | N-benzyl-2-(2-nitrophenyl)ethanamine | ||
|---|---|---|---|---|
| CAS Number | 5339-07-1 | Molecular Weight | 256.30000 | |
| Density | 1.26g/cm3 | Boiling Point | 511.6ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.2ºC | |
| Name | N-benzyl-2-(2-nitrophenyl)ethanamine |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 511.6ºC at 760 mmHg |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30000 |
| Flash Point | 263.2ºC |
| Exact Mass | 256.12100 |
| PSA | 57.85000 |
| LogP | 3.84120 |
| Index of Refraction | 1.649 |
| InChIKey | DJEFWEWOFVLRPW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1CCNCc1ccccc1 |
| HS Code | 2921499090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |