(9E)-9-[(2,4-dinitrophenyl)hydrazinylidene]-1,3-dimethylbenzo[f][2]benzofuran-4-one structure
|
Common Name | (9E)-9-[(2,4-dinitrophenyl)hydrazinylidene]-1,3-dimethylbenzo[f][2]benzofuran-4-one | ||
|---|---|---|---|---|
| CAS Number | 5339-16-2 | Molecular Weight | 406.34800 | |
| Density | 1.54g/cm3 | Boiling Point | 619.6ºC at 760 mmHg | |
| Molecular Formula | C20H14N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328.6ºC | |
| Name | (9E)-9-[(2,4-dinitrophenyl)hydrazinylidene]-1,3-dimethylbenzo[f][2]benzofuran-4-one |
|---|
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 619.6ºC at 760 mmHg |
| Molecular Formula | C20H14N4O6 |
| Molecular Weight | 406.34800 |
| Flash Point | 328.6ºC |
| Exact Mass | 406.09100 |
| PSA | 146.24000 |
| LogP | 5.24110 |
| Index of Refraction | 1.721 |
| InChIKey | NGURONRDMDHUML-UHFFFAOYSA-N |
| SMILES | Cc1oc(C)c2c(N=Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c3ccccc3c(O)c12 |
| HS Code | 2932999099 |
|---|
|
~%
(9E)-9-[(2,4-di... CAS#:5339-16-2 |
| Literature: Nightingale; Sukornick Journal of Organic Chemistry, 1959 , vol. 24, p. 497,500 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |