1-[2-(2-nitrophenyl)ethyl]piperidine structure
|
Common Name | 1-[2-(2-nitrophenyl)ethyl]piperidine | ||
|---|---|---|---|---|
| CAS Number | 5339-23-1 | Molecular Weight | 234.29400 | |
| Density | 1.128g/cm3 | Boiling Point | 338.5ºC at 760 mmHg | |
| Molecular Formula | C13H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.5ºC | |
| Name | 1-[2-(2-nitrophenyl)ethyl]piperidine |
|---|
| Density | 1.128g/cm3 |
|---|---|
| Boiling Point | 338.5ºC at 760 mmHg |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.29400 |
| Flash Point | 158.5ºC |
| Exact Mass | 234.13700 |
| PSA | 49.06000 |
| LogP | 3.08430 |
| Index of Refraction | 1.558 |
| InChIKey | MKHHHLKXRBAODK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1CCN1CCCCC1 |
|
~%
1-[2-(2-nitroph... CAS#:5339-23-1 |
| Literature: Dale; Buell Journal of Organic Chemistry, 1956 , vol. 21, p. 45,47 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |