Benzenearsonic acid, p-(4-biphenylylsulfamoyl)- (8CI) structure
|
Common Name | Benzenearsonic acid, p-(4-biphenylylsulfamoyl)- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 5339-65-1 | Molecular Weight | 433.31000 | |
| Density | N/A | Boiling Point | 685.8ºC at 760mmHg | |
| Molecular Formula | C18H16AsNO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 368.6ºC | |
| Name | [4-[(4-phenylphenyl)sulfamoyl]phenyl]arsonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 685.8ºC at 760mmHg |
|---|---|
| Molecular Formula | C18H16AsNO5S |
| Molecular Weight | 433.31000 |
| Flash Point | 368.6ºC |
| Exact Mass | 432.99700 |
| PSA | 112.08000 |
| LogP | 2.86920 |
| InChIKey | IGKUASBKQOJZTK-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Nc1ccc(-c2ccccc2)cc1)c1ccc([As](=O)(O)O)cc1 |
| HS Code | 2935009090 |
|---|
|
~%
Benzenearsonic ... CAS#:5339-65-1 |
| Literature: Way; Oneto Journal of the American Chemical Society, 1942 , vol. 64, p. 1287 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| antineoplastic-3545 |