Benzenebutanoic acid, g-[2-(dimethylamino)propyl]-g-phenyl- structure
|
Common Name | Benzenebutanoic acid, g-[2-(dimethylamino)propyl]-g-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 5340-16-9 | Molecular Weight | 325.44500 | |
| Density | 1.07g/cm3 | Boiling Point | 460.5ºC at 760 mmHg | |
| Molecular Formula | C21H27NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.3ºC | |
| Name | 6-(dimethylamino)-4,4-diphenylheptanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 460.5ºC at 760 mmHg |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.44500 |
| Flash Point | 232.3ºC |
| Exact Mass | 325.20400 |
| PSA | 40.54000 |
| LogP | 4.17770 |
| Index of Refraction | 1.554 |
| InChIKey | WYQSLXSVBQFXJG-UHFFFAOYSA-N |
| SMILES | CC(CC(CCC(=O)O)(c1ccccc1)c1ccccc1)N(C)C |
|
~%
Benzenebutanoic... CAS#:5340-16-9 |
| Literature: Perrine; May Journal of Organic Chemistry, 1954 , vol. 19, p. 773,777 |
| 6-Dimethylamino-4,4-diphenyl-heptansaeure |
| 6-dimethylamino-4,4-diphenyl-heptanoic acid |