Pentanoic acid, 2-(1,1-dimethylethyl)-2,4,4-trimethyl structure
|
Common Name | Pentanoic acid, 2-(1,1-dimethylethyl)-2,4,4-trimethyl | ||
|---|---|---|---|---|
| CAS Number | 5340-83-0 | Molecular Weight | 200.31800 | |
| Density | 0.904g/cm3 | Boiling Point | 284.3ºC at 760mmHg | |
| Molecular Formula | C12H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.7ºC | |
| Name | 2-tert-butyl-2,4,4-trimethylpentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 0.904g/cm3 |
|---|---|
| Boiling Point | 284.3ºC at 760mmHg |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.31800 |
| Flash Point | 124.7ºC |
| Exact Mass | 200.17800 |
| PSA | 37.30000 |
| LogP | 3.55960 |
| Index of Refraction | 1.446 |
| InChIKey | CRLCLCBFULTTTR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C(=O)O)C(C)(C)C |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 2-tert-Butyl-2,4,4-trimethyl-valeriansaeure |
| 2-TERT-BUTYL-2,4-TRIMETHYLPENTANOIC ACID |
| 2.2.3.5.5-Pentamethyl-hexan-carbonsaeure-(3) |
| Methyl-tert.-butyl-neopentyl-essigsaeure |
| (+-)-2-tert-butyl-2,4,4-trimethyl-valeric acid |