Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, 3-(3-butoxypropoxy)propyl ester
Modify Date: 2026-08-21 12:19:00
Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, 3-(3-butoxypropoxy)propyl ester structure
|
Common Name | Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, 3-(3-butoxypropoxy)propyl ester | ||
|---|---|---|---|---|
| CAS Number | 53404-07-2 | Molecular Weight | 441.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H27Cl3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, 3-(3-butoxypropoxy)propyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H27Cl3O5 |
|---|---|
| Molecular Weight | 441.8 |
| InChIKey | RVEHLGSSFKYLDW-UHFFFAOYSA-N |
| SMILES | CCCCOCCCOCCCOC(=O)C(C)Oc1cc(Cl)c(Cl)cc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, 3-(3-butoxypropoxy)propyl ester? |
| A: InChIKey of Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, 3-(3-butoxypropoxy)propyl ester is RVEHLGSSFKYLDW-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 53404-07-2? |
| A: Chinese name of 53404-07-2 is 53404-07-2. |
| Q: What is the SMILES notation of Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, 3-(3-butoxypropoxy)propyl ester? |
| A: SMILES notation of Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, 3-(3-butoxypropoxy)propyl ester is CCCCOCCCOCCCOC(=O)C(C)Oc1cc(Cl)c(Cl)cc1Cl. |
| Q: What is the English name of Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, 3-(3-butoxypropoxy)propyl ester? |
| A: The English name of Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, 3-(3-butoxypropoxy)propyl ester is Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, 3-(3-butoxypropoxy)propyl ester. |
| Q: What is the molecular weight of Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, 3-(3-butoxypropoxy)propyl ester? |
| A: Molecular weight of Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, 3-(3-butoxypropoxy)propyl ester is 441.8. |
| Q: What is the molecular formula of Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, 3-(3-butoxypropoxy)propyl ester? |
| A: Molecular formula of Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, 3-(3-butoxypropoxy)propyl ester is C19H27Cl3O5. |
| Q: What is the CAS number of Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, 3-(3-butoxypropoxy)propyl ester? |
| A: CAS number of Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, 3-(3-butoxypropoxy)propyl ester is 53404-07-2. |