chloramben-diolamine structure
|
Common Name | chloramben-diolamine | ||
|---|---|---|---|---|
| CAS Number | 53404-16-3 | Molecular Weight | 311.16200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | chloramben-diolamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H16Cl2N2O4 |
|---|---|
| Molecular Weight | 311.16200 |
| Exact Mass | 310.04900 |
| PSA | 115.81000 |
| LogP | 1.80650 |
| InChIKey | NXZLJFLADUDSQR-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)cc(C(=O)O)c1Cl.OCCNCCO |
| Chloramben-diolamine |
| Benzoic acid,3-amino-2,5-dichloro-,compd. with 2,2'-iminobis(ethanol) (1:1) |
| 3-amino-2,5-dichlorobenzoic—2,2’-azanediyldi(ethan-1-ol) |
| 3-amino-2,5-dichlorobenzoic acid,2-(2-hydroxyethylamino)ethanol |
| bis(2-hydroxyethyl)ammonium 3-amino-2,5-dichlorobenzoate |
| 3-amino-2,5-dichlorobenzoic acid - 2,2’-iminodiethanol (1:1) |
| Chloramben-diolamine [ISO] |
| 3-amino-2,5-dichlorobenzoic acid compound with 2,2’-iminobis[ethanol] (1:1) |
| 3-Amino-2,5-dichlorobenzoic diethanolamine salt |