(p-chlorophenoxy)acetic acid, compound with 2,2'-iminodiethanol (1:1) structure
|
Common Name | (p-chlorophenoxy)acetic acid, compound with 2,2'-iminodiethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 53404-23-2 | Molecular Weight | 291.72800 | |
| Density | N/A | Boiling Point | 315.2ºC at 760 mmHg | |
| Molecular Formula | C12H18ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.4ºC | |
| Name | 4-CPA-diolamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 315.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H18ClNO5 |
| Molecular Weight | 291.72800 |
| Flash Point | 144.4ºC |
| Exact Mass | 291.08700 |
| PSA | 99.02000 |
| LogP | 0.75490 |
| InChIKey | WVWKBBSRDNKDIX-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1ccc(Cl)cc1.OCCNCCO |
| 2-(4-chlorophenoxy)acetic acid compound with 2,2’-iminobis[ethanol] (1:1) |
| EINECS 258-526-3 |
| Diethanolamine 4-chlorophenoxyacetate |
| (p-Chlorophenoxy)acetic acid,compound with 2,2'-iminodiethanol (1:1) |
| (4-chlorophenoxy)acetic acid—2,2’-azanediyldi(ethan-1-ol) |
| 2-(4-chlorophenoxy)acetic acid,2-(2-hydroxyethylamino)ethanol |
| (4-chlorophenoxy)acetic acid - 2,2’-iminodiethanol (1:1) |
| 4-Chlorophenoxyacetic acid diethanolamine salt |
| 2-(4-chlorophenoxy)acetic acid |
| Acetic acid,(p-chlorophenoxy)-,compd. with 2,2'-iminodiethanol |
| Ethanol,2,2'-iminobis-,(4-chlorophenoxy)acetate (salt) |
| Acetic acid,(4-chlorophenoxy)-,compd. with 2,2'-iminobis(ethanol) (1:1) |
| bis(2-hydroxyethyl)ammonium (4-chlorophenoxy)acetate |