Benzoic acid, 3,6-dichloro-2-methoxy-, compd. with 2,2,2-nitrilotrisethanol (1:1) structure
|
Common Name | Benzoic acid, 3,6-dichloro-2-methoxy-, compd. with 2,2,2-nitrilotrisethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 53404-29-8 | Molecular Weight | 370.22600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21Cl2NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dicamba-trolamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H21Cl2NO6 |
|---|---|
| Molecular Weight | 370.22600 |
| Exact Mass | 369.07500 |
| PSA | 110.46000 |
| LogP | 0.96550 |
| InChIKey | ZMLZTMPXQOOCNI-UHFFFAOYSA-N |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)O.OCCN(CCO)CCO |
| HS Code | 2923900090 |
|---|
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzoic acid,3,6-dichloro-2-methoxy-,compd. with 2,2',2''-nitrilotris(ethanol) (1:1) |
| 3,6-dichloro-2-methoxybenzoic acid - 2,2’,2″-nitrilotriethanol (1:1) |
| 2-[bis(2-hydroxyethyl)amino]ethanol,3,6-dichloro-2-methoxybenzoic acid |
| tris(2-hydroxyethyl)ammonium 3,6-dichloro-2-methoxybenzoate |
| Dicamba-trolamine [ISO] |
| 3,6-dichloro-2-methoxybenzoic acid—2,2’,2″-nitrilotri(ethan-1-ol) |
| 3,6-dichloro-o-anisic acid - 2,2’,2″-nitrilotriethanol (1:1) |
| tris(2-hydroxyethyl)ammonium 3,6-dichloro-o-anisate |
| 3,6-dichloro-2-methoxybenzoic acid compound with 2,2’,2″-nitrilotris[ethanol] (1:1) |
| Dicamba-trolamine |