2,4-d Linoleylammonium
Modify Date: 2025-09-12 21:03:30
2,4-d Linoleylammonium structure
|
Common Name | 2,4-d Linoleylammonium | ||
|---|---|---|---|---|
| CAS Number | 53404-38-9 | Molecular Weight | 486.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H41Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-d Linoleylammonium |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H41Cl2NO3 |
|---|---|
| Molecular Weight | 486.5 |
| InChIKey | WBNXMKUVSUASSY-NBTZWHCOSA-N |
| SMILES | CCCCCC=CCC=CCCCCCCCCN.O=C(O)COc1ccc(Cl)cc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2,4-d Linoleylammonium? |
| A: Molecular formula of 2,4-d Linoleylammonium is C26H41Cl2NO3. |
| Q: What is the molecular weight of 2,4-d Linoleylammonium? |
| A: Molecular weight of 2,4-d Linoleylammonium is 486.5. |
| Q: What is the Chinese name of 53404-38-9? |
| A: Chinese name of 53404-38-9 is 53404-38-9. |
| Q: What is the English name of 2,4-d Linoleylammonium? |
| A: The English name of 2,4-d Linoleylammonium is 2,4-d Linoleylammonium. |
| Q: What is the CAS number of 2,4-d Linoleylammonium? |
| A: CAS number of 2,4-d Linoleylammonium is 53404-38-9. |
| Q: What is the InChIKey of 2,4-d Linoleylammonium? |
| A: InChIKey of 2,4-d Linoleylammonium is WBNXMKUVSUASSY-NBTZWHCOSA-N. |
| Q: What is the SMILES notation of 2,4-d Linoleylammonium? |
| A: SMILES notation of 2,4-d Linoleylammonium is CCCCCC=CCC=CCCCCCCCCN.O=C(O)COc1ccc(Cl)cc1Cl. |