2-Neopentyloxo-1,3-indandione calcium (2:1)
Modify Date: 2026-09-22 14:31:59
2-Neopentyloxo-1,3-indandione calcium (2:1) structure
|
Common Name | 2-Neopentyloxo-1,3-indandione calcium (2:1) | ||
|---|---|---|---|---|
| CAS Number | 53404-72-1 | Molecular Weight | 498.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H26CaO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Neopentyloxo-1,3-indandione calcium (2:1) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C28H26CaO6 |
|---|---|
| Molecular Weight | 498.6 |
| InChIKey | ABRROSYGYHNWQQ-UHFFFAOYSA-L |
| SMILES | CC(C)(C)C(=O)C1=C([O-])c2ccccc2C1=O.CC(C)(C)C(=O)C1=C([O-])c2ccccc2C1=O.[Ca+2] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-Neopentyloxo-1,3-indandione calcium (2:1)? |
| A: SMILES notation of 2-Neopentyloxo-1,3-indandione calcium (2:1) is CC(C)(C)C(=O)C1=C([O-])c2ccccc2C1=O.CC(C)(C)C(=O)C1=C([O-])c2ccccc2C1=O.[Ca+2]. |
| Q: What is the molecular formula of 2-Neopentyloxo-1,3-indandione calcium (2:1)? |
| A: Molecular formula of 2-Neopentyloxo-1,3-indandione calcium (2:1) is C28H26CaO6. |
| Q: What is the Chinese name of 53404-72-1? |
| A: Chinese name of 53404-72-1 is 53404-72-1. |
| Q: What is the molecular weight of 2-Neopentyloxo-1,3-indandione calcium (2:1)? |
| A: Molecular weight of 2-Neopentyloxo-1,3-indandione calcium (2:1) is 498.6. |
| Q: What is the English name of 2-Neopentyloxo-1,3-indandione calcium (2:1)? |
| A: The English name of 2-Neopentyloxo-1,3-indandione calcium (2:1) is 2-Neopentyloxo-1,3-indandione calcium (2:1). |
| Q: What is the InChIKey of 2-Neopentyloxo-1,3-indandione calcium (2:1)? |
| A: InChIKey of 2-Neopentyloxo-1,3-indandione calcium (2:1) is ABRROSYGYHNWQQ-UHFFFAOYSA-L. |
| Q: What is the CAS number of 2-Neopentyloxo-1,3-indandione calcium (2:1)? |
| A: CAS number of 2-Neopentyloxo-1,3-indandione calcium (2:1) is 53404-72-1. |