Sodium 2,4,5-trichlorophenylacetate
Modify Date: 2025-08-21 22:26:51
Sodium 2,4,5-trichlorophenylacetate structure
|
Common Name | Sodium 2,4,5-trichlorophenylacetate | ||
|---|---|---|---|---|
| CAS Number | 53404-91-4 | Molecular Weight | 261.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4Cl3NaO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sodium 2,4,5-trichlorophenylacetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H4Cl3NaO2 |
|---|---|
| Molecular Weight | 261.5 |
| InChIKey | SPAOUGSHIFOWDT-UHFFFAOYSA-M |
| SMILES | O=C([O-])Cc1cc(Cl)c(Cl)cc1Cl.[Na+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Sodium 2,4,5-trichlorophenylacetate? |
| A: Molecular weight of Sodium 2,4,5-trichlorophenylacetate is 261.5. |
| Q: What is the InChIKey of Sodium 2,4,5-trichlorophenylacetate? |
| A: InChIKey of Sodium 2,4,5-trichlorophenylacetate is SPAOUGSHIFOWDT-UHFFFAOYSA-M. |
| Q: What is the Chinese name of 53404-91-4? |
| A: Chinese name of 53404-91-4 is 53404-91-4. |
| Q: What is the CAS number of Sodium 2,4,5-trichlorophenylacetate? |
| A: CAS number of Sodium 2,4,5-trichlorophenylacetate is 53404-91-4. |
| Q: What is the molecular formula of Sodium 2,4,5-trichlorophenylacetate? |
| A: Molecular formula of Sodium 2,4,5-trichlorophenylacetate is C8H4Cl3NaO2. |
| Q: What is the SMILES notation of Sodium 2,4,5-trichlorophenylacetate? |
| A: SMILES notation of Sodium 2,4,5-trichlorophenylacetate is O=C([O-])Cc1cc(Cl)c(Cl)cc1Cl.[Na+]. |
| Q: What is the English name of Sodium 2,4,5-trichlorophenylacetate? |
| A: The English name of Sodium 2,4,5-trichlorophenylacetate is Sodium 2,4,5-trichlorophenylacetate. |