5-[(2,4-dinitrophenyl)amino]penta-2,4-dienal structure
|
Common Name | 5-[(2,4-dinitrophenyl)amino]penta-2,4-dienal | ||
|---|---|---|---|---|
| CAS Number | 53405-99-5 | Molecular Weight | 263.20600 | |
| Density | 1.437g/cm3 | Boiling Point | 451.5ºC at 760 mmHg | |
| Molecular Formula | C11H9N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.9ºC | |
| Name | (2Z,4Z)-5-(2,4-dinitroanilino)penta-2,4-dienal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.437g/cm3 |
|---|---|
| Boiling Point | 451.5ºC at 760 mmHg |
| Molecular Formula | C11H9N3O5 |
| Molecular Weight | 263.20600 |
| Flash Point | 226.9ºC |
| Exact Mass | 263.05400 |
| PSA | 120.74000 |
| LogP | 3.30310 |
| Index of Refraction | 1.662 |
| InChIKey | BKAXRHZDPTUAIN-UHFFFAOYSA-N |
| SMILES | O=CC=CC=CNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| pentenedial-bis-dimethylacetal |
| 1-(2,4-Dinitro-anilino)-penta-1,3-dien-5-al |
| Glutacondialdehyd-mono-(2.4-dinitro-anil) |
| glutaconaldehyde bis-(dimethyl acetal) |
| 5-<2.4-Dinitro-phenylamino>-pentadien-(2.4)-al |
| 5-(2,4-Dinitro-anilino)-glutaconaldehyd |
| Petendial-bis-dimethylacetal |
| Glutacondialdehyd-bis-dimethylacetal |
| 5-(2,4-dinitro-anilino)-penta-2,4-dienal |
| 1,1,5,5-tetramethoxy-pent-2-ene |
| 5-(2,4-Dinitro-anilino)-2,4-pentadienal |
| 2-Pentene,1,1,5,5-tetramethoxy |