N-[(2-chlorophenyl)carbamoyl]-2-(3-methylpiperidin-1-yl)acetamide structure
|
Common Name | N-[(2-chlorophenyl)carbamoyl]-2-(3-methylpiperidin-1-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 53412-99-0 | Molecular Weight | 309.79100 | |
| Density | 1.236g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H20ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(2-chlorophenyl)carbamoyl]-2-(3-methylpiperidin-1-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.236g/cm3 |
|---|---|
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.79100 |
| Exact Mass | 309.12400 |
| PSA | 68.42000 |
| LogP | 3.51180 |
| Index of Refraction | 1.577 |
| InChIKey | XZFKVZMVKORLEV-UHFFFAOYSA-N |
| SMILES | CC1CCCN(CC(=O)NC(=O)Nc2ccccc2Cl)C1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(((2-Chlorophenyl)amino)carbonyl)-3-methyl-1-piperidineacetamide |
| 1-Piperidineacetamide,N-(((2-chlorophenyl)amino)carbonyl)-3-methyl |
| N-(2-chloro-phenylcarbamoyl)-2-(3-methyl-piperidin-1-yl)-acetamide |