Butanedioic acid,1-[2-(3-carboxy-1-oxopropyl)hydrazide] structure
|
Common Name | Butanedioic acid,1-[2-(3-carboxy-1-oxopropyl)hydrazide] | ||
|---|---|---|---|---|
| CAS Number | 5343-02-2 | Molecular Weight | 232.19100 | |
| Density | 1.435g/cm3 | Boiling Point | 660.5ºC at 760mmHg | |
| Molecular Formula | C8H12N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 353.3ºC | |
| Name | 4-[2-(3-carboxypropanoyl)hydrazinyl]-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.435g/cm3 |
|---|---|
| Boiling Point | 660.5ºC at 760mmHg |
| Molecular Formula | C8H12N2O6 |
| Molecular Weight | 232.19100 |
| Flash Point | 353.3ºC |
| Exact Mass | 232.07000 |
| PSA | 132.80000 |
| Index of Refraction | 1.524 |
| InChIKey | LWMZMSTWHMTCOP-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)NNC(=O)CCC(=O)O |
| HS Code | 2928000090 |
|---|
|
~%
Butanedioic aci... CAS#:5343-02-2 |
| Literature: Feuer et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 4716,4717 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N,N'-bis-(3-carboxy-propionyl)-hydrazine |
| Hydrazidibernsteinsaeure |
| Hydrazine,1,2-bis(3-carboxypropionyl) |
| N,N'-Disuccinylhydrazin |
| N.N'-Bis-(o-carboxypropionylhydrazid) |
| 1,2-Bis(3-carboxypropanoyl)-hydrazine |