Benzoic acid,4-[(2-hydroxybenzoyl)amino] structure
|
Common Name | Benzoic acid,4-[(2-hydroxybenzoyl)amino] | ||
|---|---|---|---|---|
| CAS Number | 5344-07-0 | Molecular Weight | 257.24100 | |
| Density | 1.434g/cm3 | Boiling Point | 397.4ºC at 760 mmHg | |
| Molecular Formula | C14H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.1ºC | |
| Name | p-[N-(2-amino-3,4-dihydro-4-oxoquinazolin-6-ylmethyl)-N-(prop-2-ynyl)amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.434g/cm3 |
|---|---|
| Boiling Point | 397.4ºC at 760 mmHg |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.24100 |
| Flash Point | 194.1ºC |
| Exact Mass | 257.06900 |
| PSA | 86.63000 |
| LogP | 2.41570 |
| Index of Refraction | 1.704 |
| InChIKey | IBZSQWHMOFFVEG-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(NC(=O)c2ccccc2O)cc1 |
| HS Code | 2924299090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Ability to promote absorption of recombinant human growth hormone from gastrointestin...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL790294
|
| Benzoic acid,4-(((2-amino-1,4-dihydro-4-oxo-6-quinazolinyl)methyl)-2-propynylamino) |
| N10-propargyl-5,8-dideazapteroic acid |
| 4-(((2-amino-3,4-dihydro-4-oxo-6-quinazolinyl)methyl) (2-propynyl)amino)benzoic acid |
| p-[N-(o-Hydroxy-benzoyl)-amino]-benzoesaeure |
| 4-{N-[(2-amino-4-hydroxy-6-quinazolinyl)methyl]prop-2-ynylamino}benzoic acid |