Potassium 4-nitro-2-sulfobenzoate structure
|
Common Name | Potassium 4-nitro-2-sulfobenzoate | ||
|---|---|---|---|---|
| CAS Number | 5344-48-9 | Molecular Weight | 285.272 | |
| Density | 1.809 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H4KNO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | potassium,4-nitro-2-sulfobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.809 g/cm3 |
|---|---|
| Molecular Formula | C7H4KNO7S |
| Molecular Weight | 285.272 |
| Exact Mass | 284.934540 |
| PSA | 148.70000 |
| LogP | 1.80110 |
| Index of Refraction | 1.643 |
| InChIKey | LDDPHQAIEFBCTC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1S(=O)(=O)O.[K] |
| HS Code | 2916399090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2-Carboxy-5-nitrobenzenesulfonic acid potassium salt |
| 4-nitro-2-sulfo-benzoic acid,monopotassium salt |
| Potassium 4-nitro-2-sulfobenzoate |
| WSQR BVQ ENW & &K salt |
| Benzoic acid,potassiumsulfonate salt |
| Benzoic acid, 4-nitro-2-sulfo-, potassium salt (1:1) |
| potassium 4-nitro-2-sulfobenzoic acid |
| 2-carboxy-5-nitrobenzenesulfonic acid monopotassium salt |