1-N,3-N-bis(4-iodophenyl)benzene-1,3-dicarboxamide structure
|
Common Name | 1-N,3-N-bis(4-iodophenyl)benzene-1,3-dicarboxamide | ||
|---|---|---|---|---|
| CAS Number | 5344-95-6 | Molecular Weight | 568.14600 | |
| Density | 1.95g/cm3 | Boiling Point | 483.3ºC at 760 mmHg | |
| Molecular Formula | C20H14I2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.1ºC | |
| Name | 1-N,3-N-bis(4-iodophenyl)benzene-1,3-dicarboxamide |
|---|
| Density | 1.95g/cm3 |
|---|---|
| Boiling Point | 483.3ºC at 760 mmHg |
| Molecular Formula | C20H14I2N2O2 |
| Molecular Weight | 568.14600 |
| Flash Point | 246.1ºC |
| Exact Mass | 567.91400 |
| PSA | 58.20000 |
| LogP | 5.54640 |
| Index of Refraction | 1.771 |
| InChIKey | KSQHIEWXNTZCMW-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(I)cc1)c1cccc(C(=O)Nc2ccc(I)cc2)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |