3,5-Dimethyl-4-nitrophenol structure
|
Common Name | 3,5-Dimethyl-4-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 5344-97-8 | Molecular Weight | 167.162 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 311.8±30.0 °C at 760 mmHg | |
| Molecular Formula | C8H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.8±13.0 °C | |
| Name | 3,5-Dimethyl-4-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 311.8±30.0 °C at 760 mmHg |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.162 |
| Flash Point | 139.8±13.0 °C |
| Exact Mass | 167.058243 |
| PSA | 66.05000 |
| LogP | 2.49 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | MMLPWOHLKRXZJA-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)cc(C)c1[N+](=O)[O-] |
| HS Code | 2908999090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2-Nitro-5-oxy-1.3-dimethyl-benzol |
| 3,5-Dimethyl-4-nitrophenol |
| 3,5-dimethyl-4-nitro-phenol |
| 4-Nitro-symm.-m-xylenol |
| 2-Nitro-5-hydroxy-m-xylol |
| 3,5-Xylenol,4-nitro |