5-formyl-2-Methoxyphenyl benzoate structure
|
Common Name | 5-formyl-2-Methoxyphenyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 53440-24-7 | Molecular Weight | 256.25300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5-formyl-2-methoxyphenyl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H12O4 |
|---|---|
| Molecular Weight | 256.25300 |
| Exact Mass | 256.07400 |
| PSA | 52.60000 |
| LogP | 2.72690 |
| InChIKey | RJJVLEKYAOMQEW-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=O)cc1OC(=O)c1ccccc1 |
| HS Code | 2916310090 |
|---|
|
~%
5-formyl-2-Meth... CAS#:53440-24-7 |
| Literature: Pschorr; Stoehrer Chemische Berichte, 1902 , vol. 35, p. 4398 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916310090 |
|---|---|
| Summary | 2916310090 other benzoic acid and its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 5-formyl-2-methoxyphenyl benzoate |
| 3-Benzoyloxy-4-methoxy-benzaldehyd |
| 3-benzoyloxy-4-methoxy-benzaldehyde |
| Isovanillinbenzoat |
| 3-formyl-6-methoxyphenyl benzoate |
| Benzoylisovanillin |
| 2-methoxy-5-formylphenyl benzoate |