3-cysteinylacetaminophen, trifluoroacetic acid salt structure
|
Common Name | 3-cysteinylacetaminophen, trifluoroacetic acid salt | ||
|---|---|---|---|---|
| CAS Number | 53446-10-9 | Molecular Weight | 270.30 | |
| Density | 1.44g/cm3 | Boiling Point | 541.1ºC at 760mmHg | |
| Molecular Formula | C11H14N2O4S | Melting Point | 190-193ºC dec. | |
| MSDS | N/A | Flash Point | 281ºC | |
Use of 3-cysteinylacetaminophen, trifluoroacetic acid saltParacetamol-cysteine is a Paracetamol-cysteine Paracetamol protein adduct (PPA) and is formed when paracetamol is oxidized to the reactive metabolite N-acetyl-p-benzoquinoneimine (NAPQI)[1]. |
| Name | (2R)-3-(5-acetamido-2-hydroxyphenyl)sulfanyl-2-aminopropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Paracetamol-cysteine is a Paracetamol-cysteine Paracetamol protein adduct (PPA) and is formed when paracetamol is oxidized to the reactive metabolite N-acetyl-p-benzoquinoneimine (NAPQI)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 541.1ºC at 760mmHg |
| Melting Point | 190-193ºC dec. |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.30 |
| Flash Point | 281ºC |
| Exact Mass | 384.06000 |
| PSA | 175.25000 |
| LogP | 2.26120 |
| Index of Refraction | 1.654 |
| InChIKey | LLHICPSCVFRWDT-QMMMGPOBSA-N |
| SMILES | CC(=O)Nc1ccc(O)c(SCC(N)C(=O)O)c1 |
| Storage condition | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| Stability | Hygroscopic |
| UNII-6Q2X58Y8BP |
| 3-Cysteinylacetaminophen Trifluoroacetic Acid Salt |
| 3-(Cystein-S-yl)paracetamol |
| 3-(Cystein-S-yl)acetaminophen |
| L-Cysteine,S-[5-(acetylamino)-2-hydroxyphenyl] |