(1,2,3,4-tetrabromo-4-phenylbutyl)benzene structure
|
Common Name | (1,2,3,4-tetrabromo-4-phenylbutyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 53446-15-4 | Molecular Weight | 525.89800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14Br4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1,2,3,4-tetrabromo-4-phenylbutyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14Br4 |
|---|---|
| Molecular Weight | 525.89800 |
| Exact Mass | 521.78300 |
| LogP | 6.78580 |
| InChIKey | MRHNHSXNEOUJKW-UHFFFAOYSA-N |
| SMILES | BrC(c1ccccc1)C(Br)C(Br)C(Br)c1ccccc1 |
|
~%
(1,2,3,4-tetrab... CAS#:53446-15-4 |
| Literature: Yamasaki; Terauchi; Takemura Chemical and Pharmaceutical Bulletin, 1976 , vol. 24, # 11 p. 2841 - 2849 |
|
~%
(1,2,3,4-tetrab... CAS#:53446-15-4 |
| Literature: Allen; Bell; Gates Journal of Organic Chemistry, 1943 , vol. 8, p. 373,376 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| 1,2,3,4-Tetrabrom-1,4-diphenylbutan |
| Benzene,1,1'-(1,2,3,4-tetrabromo-1,4-butanediyl)bis |
| 1,4-Diphenyl-1,2,3,4-tetrabrombutan |
| 1,2,3,4-tetrabromo-1,4-diphenyl-butane |