(1,2,3,4-tetrabromo-4-phenylbutyl)benzene
(1,2,3,4-tetrabromo-4-phenylbutyl)benzene structure
|
Common Name | (1,2,3,4-tetrabromo-4-phenylbutyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 53446-15-4 | Molecular Weight | 525.89800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14Br4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1,2,3,4-tetrabromo-4-phenylbutyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H14Br4 |
|---|---|
| Molecular Weight | 525.89800 |
| Exact Mass | 521.78300 |
| LogP | 6.78580 |
| InChIKey | MRHNHSXNEOUJKW-UHFFFAOYSA-N |
| SMILES | BrC(c1ccccc1)C(Br)C(Br)C(Br)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(1,2,3,4-tetrab... CAS#:53446-15-4 |
| Literature: Yamasaki; Terauchi; Takemura Chemical and Pharmaceutical Bulletin, 1976 , vol. 24, # 11 p. 2841 - 2849 |
|
~%
(1,2,3,4-tetrab... CAS#:53446-15-4 |
| Literature: Allen; Bell; Gates Journal of Organic Chemistry, 1943 , vol. 8, p. 373,376 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,2,3,4-Tetrabrom-1,4-diphenylbutan |
| Benzene,1,1'-(1,2,3,4-tetrabromo-1,4-butanediyl)bis |
| 1,4-Diphenyl-1,2,3,4-tetrabrombutan |
| 1,2,3,4-tetrabromo-1,4-diphenyl-butane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (1,2,3,4-tetrabromo-4-phenylbutyl)benzene? |
| A: InChIKey of (1,2,3,4-tetrabromo-4-phenylbutyl)benzene is MRHNHSXNEOUJKW-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of (1,2,3,4-tetrabromo-4-phenylbutyl)benzene? |
| A: SMILES notation of (1,2,3,4-tetrabromo-4-phenylbutyl)benzene is BrC(c1ccccc1)C(Br)C(Br)C(Br)c1ccccc1. |
| Q: What English synonyms does (1,2,3,4-tetrabromo-4-phenylbutyl)benzene have? |
| A: English synonyms of (1,2,3,4-tetrabromo-4-phenylbutyl)benzene: 1,2,3,4-Tetrabrom-1,4-diphenylbutan, Benzene,1,1'-(1,2,3,4-tetrabromo-1,4-butanediyl)bis, 1,4-Diphenyl-1,2,3,4-tetrabrombutan, 1,2,3,4-tetrabromo-1,4-diphenyl-butane. |
| Q: What is the LogP of (1,2,3,4-tetrabromo-4-phenylbutyl)benzene? |
| A: LogP of (1,2,3,4-tetrabromo-4-phenylbutyl)benzene is 6.78580. |
| Q: What is the Chinese name of 53446-15-4? |
| A: Chinese name of 53446-15-4 is 53446-15-4. |
| Q: What is the English name of (1,2,3,4-tetrabromo-4-phenylbutyl)benzene? |
| A: The English name of (1,2,3,4-tetrabromo-4-phenylbutyl)benzene is (1,2,3,4-tetrabromo-4-phenylbutyl)benzene. |
| Q: What is the molecular formula of (1,2,3,4-tetrabromo-4-phenylbutyl)benzene? |
| A: Molecular formula of (1,2,3,4-tetrabromo-4-phenylbutyl)benzene is C16H14Br4. |
| Q: What is the molecular weight of (1,2,3,4-tetrabromo-4-phenylbutyl)benzene? |
| A: Molecular weight of (1,2,3,4-tetrabromo-4-phenylbutyl)benzene is 525.89800. |
| Q: What are the upstream materials of (1,2,3,4-tetrabromo-4-phenylbutyl)benzene? |
| A: Related upstream materials(CAS) of (1,2,3,4-tetrabromo-4-phenylbutyl)benzene: 886-65-7;67-66-3;7726-95-6. |
| Q: What are the downstream products of (1,2,3,4-tetrabromo-4-phenylbutyl)benzene? |
| A: Related downstream products(CAS) of (1,2,3,4-tetrabromo-4-phenylbutyl)benzene: 886-65-7. |