2-(4-chloro-3,5-dimethyl-phenoxy)-N-[2-(4-methyl-1-piperidyl)phenyl]acetamide structure
|
Common Name | 2-(4-chloro-3,5-dimethyl-phenoxy)-N-[2-(4-methyl-1-piperidyl)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 5345-07-3 | Molecular Weight | 382.37000 | |
| Density | 1.18g/cm3 | Boiling Point | 582.8ºC at 760 mmHg | |
| Molecular Formula | C19H18N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.2ºC | |
| Name | 2-cyano-4-(4-nitrophenyl)-2-[2-(4-nitrophenyl)ethyl]butanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 582.8ºC at 760 mmHg |
| Molecular Formula | C19H18N4O5 |
| Molecular Weight | 382.37000 |
| Flash Point | 306.2ºC |
| Exact Mass | 382.12800 |
| PSA | 158.52000 |
| LogP | 4.81038 |
| Index of Refraction | 1.591 |
| InChIKey | KGLQBCZBYLVUQX-UHFFFAOYSA-N |
| SMILES | N#CC(CCc1ccccc1[N+](=O)[O-])(CCc1ccccc1[N+](=O)[O-])C(N)=O |
|
~%
2-(4-chloro-3,5... CAS#:5345-07-3 |
| Literature: Dale; Strobel Journal of the American Chemical Society, 1954 , vol. 76, p. 6172 |
|
~%
2-(4-chloro-3,5... CAS#:5345-07-3 |
| Literature: Dale; Strobel Journal of the American Chemical Society, 1954 , vol. 76, p. 6172 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Cyan-2-(2-cyan-aethyl)-3,3-dimethyl-glutarsaeure-diaethylester |
| 2-cyano-2-(2-nitro-phenethyl)-4-(2-nitro-phenyl)-butyric acid amide |
| 2-cyano-2-(2-cyano-ethyl)-3,3-dimethyl-glutaric acid diethyl ester |
| Pentanedioic acid,2-cyano-2-(2-cyanoethyl)-3,3-dimethyl-,diethyl ester |
| 4-Ethoxycarbonyl-4,6-dicyan-3,3-dimethyl-capronsaeure-diethylester |
| 2-Cyan-2-(2-nitro-phenaethyl)-4-(2-nitro-phenyl)-buttersaeure-amid |