Pyridine,2-[1-chloro-2-(4-nitrophenyl)ethyl]- structure
|
Common Name | Pyridine,2-[1-chloro-2-(4-nitrophenyl)ethyl]- | ||
|---|---|---|---|---|
| CAS Number | 5345-11-9 | Molecular Weight | 262.69200 | |
| Density | 1.312g/cm3 | Boiling Point | 392.4ºC at 760 mmHg | |
| Molecular Formula | C13H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.1ºC | |
| Name | 2-[1-chloro-2-(4-nitrophenyl)ethyl]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.312g/cm3 |
|---|---|
| Boiling Point | 392.4ºC at 760 mmHg |
| Molecular Formula | C13H11ClN2O2 |
| Molecular Weight | 262.69200 |
| Flash Point | 191.1ºC |
| Exact Mass | 262.05100 |
| PSA | 58.71000 |
| LogP | 4.03560 |
| Index of Refraction | 1.614 |
| InChIKey | DSFZZWIADVRZBV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CC(Cl)c2ccccn2)cc1 |
|
~%
Pyridine,2-[1-c... CAS#:5345-11-9 |
| Literature: Dale; Ise Journal of the American Chemical Society, 1954 , vol. 76, p. 2259 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-<1-Chlor-2-(4-nitro-phenyl)-ethyl>-pyridin |
| HMS3091N03 |