methyl 2,2-bis[2-(4-nitrophenyl)ethyl]-3-oxo-butanoate structure
|
Common Name | methyl 2,2-bis[2-(4-nitrophenyl)ethyl]-3-oxo-butanoate | ||
|---|---|---|---|---|
| CAS Number | 5345-20-0 | Molecular Weight | 414.40900 | |
| Density | 1.283g/cm3 | Boiling Point | 580.5ºC at 760 mmHg | |
| Molecular Formula | C21H22N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.2ºC | |
| Name | methyl 2,2-bis[2-(4-nitrophenyl)ethyl]-3-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 580.5ºC at 760 mmHg |
| Molecular Formula | C21H22N2O7 |
| Molecular Weight | 414.40900 |
| Flash Point | 225.2ºC |
| Exact Mass | 414.14300 |
| PSA | 135.01000 |
| LogP | 4.86320 |
| Index of Refraction | 1.58 |
| InChIKey | YNSBZUQDKWDXRD-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CCc1ccc([N+](=O)[O-])cc1)(CCc1ccc([N+](=O)[O-])cc1)C(C)=O |
| HS Code | 2918300090 |
|---|
|
~%
methyl 2,2-bis[... CAS#:5345-20-0 |
| Literature: Dale; Strobel Journal of the American Chemical Society, 1954 , vol. 76, p. 6172 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| METHYL 2,2-BIS[2-(4-NITROPHENYL)ETHYL]-3-OXO-BUTANOATE |
| 2,2-Bis-(4-nitro-phenaethyl)-acetessigsaeure-methylester |
| 2,2-bis-(4-nitro-phenethyl)-acetoacetic acid methyl ester |