Benzenebutanoic acid, a-acetyl-2-nitro-, methyl ester structure
|
Common Name | Benzenebutanoic acid, a-acetyl-2-nitro-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 5345-21-1 | Molecular Weight | 265.26200 | |
| Density | 1.219g/cm3 | Boiling Point | 403.5ºC at 760mmHg | |
| Molecular Formula | C13H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.7ºC | |
| Name | methyl 2-[2-(2-nitrophenyl)ethyl]-3-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 403.5ºC at 760mmHg |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26200 |
| Flash Point | 171.7ºC |
| Exact Mass | 265.09500 |
| PSA | 89.19000 |
| LogP | 2.42880 |
| Index of Refraction | 1.53 |
| InChIKey | IPZPRFPPFMZPCX-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CCc1ccccc1[N+](=O)[O-])C(C)=O |
| HS Code | 2918300090 |
|---|
|
~%
Benzenebutanoic... CAS#:5345-21-1 |
| Literature: Dale; Strobel Journal of the American Chemical Society, 1954 , vol. 76, p. 6172 |
|
~%
Benzenebutanoic... CAS#:5345-21-1 |
| Literature: Dale; Strobel Journal of the American Chemical Society, 1954 , vol. 76, p. 6172 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-(2-nitro-phenethyl)-acetoacetic acid methyl ester |
| 2-(2-Nitro-phenaethyl)-acetessigsaeure-methylester |
| Benzenebutanoic acid,a-acetyl-2-nitro-,methyl ester |