Propanedioic acid,ethyl[2-(2-nitrophenyl)ethyl]-, diethyl ester (9CI) structure
|
Common Name | Propanedioic acid,ethyl[2-(2-nitrophenyl)ethyl]-, diethyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 5345-28-8 | Molecular Weight | 337.36800 | |
| Density | 1.164g/cm3 | Boiling Point | 442.6ºC at 760mmHg | |
| Molecular Formula | C17H23NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.3ºC | |
| Name | diethyl 2-ethyl-2-[2-(2-nitrophenyl)ethyl]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 442.6ºC at 760mmHg |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.36800 |
| Flash Point | 164.3ºC |
| Exact Mass | 337.15300 |
| PSA | 98.42000 |
| LogP | 3.57320 |
| Index of Refraction | 1.516 |
| InChIKey | OGGDIGKWJMPBAD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC)(CCc1ccccc1[N+](=O)[O-])C(=O)OCC |
| HS Code | 2917190090 |
|---|
|
~%
Propanedioic ac... CAS#:5345-28-8 |
| Literature: Dale; Strobel Journal of the American Chemical Society, 1954 , vol. 76, p. 6172 |
|
~%
Propanedioic ac... CAS#:5345-28-8 |
| Literature: Dale; Strobel Journal of the American Chemical Society, 1954 , vol. 76, p. 6172 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Aethyl-(2-nitro-phenaethyl)-malonsaeure-diaethylester |
| ethyl-(2-nitro-phenethyl)-malonic acid diethyl ester |
| diethyl ethyl[2-(2-nitrophenyl)ethyl]propanedioate |