1-[6-(1,2-dihydroxyethyl)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]ethane-1,2-diol structure
|
Common Name | 1-[6-(1,2-dihydroxyethyl)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]ethane-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 5345-81-3 | Molecular Weight | 300.30400 | |
| Density | 1.423g/cm3 | Boiling Point | 617.3ºC at 760 mmHg | |
| Molecular Formula | C14H20O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 327.1ºC | |
| Name | 3,5-o-benzylidene-meso-glycero-gulo-heptitol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.423g/cm3 |
|---|---|
| Boiling Point | 617.3ºC at 760 mmHg |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.30400 |
| Flash Point | 327.1ºC |
| Exact Mass | 300.12100 |
| PSA | 119.61000 |
| Index of Refraction | 1.601 |
| InChIKey | DWZYXBVHBFMEFT-UHFFFAOYSA-N |
| SMILES | OCC(O)C1OC(c2ccccc2)OC(C(O)CO)C1O |
|
~%
1-[6-(1,2-dihyd... CAS#:5345-81-3 |
| Literature: Hann; Ness; Hudson Journal of the American Chemical Society, 1946 , vol. 68, p. 1772 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,6-Anhydro-3,4-O-isopropylidene-2-tosyl--D-galactopyranose |
| 1,6-Anhydro-3,4-O-isopropylidene-B-D-galactopyranose 4-toluenesulfonate |
| 1,6-Anhydro-3,4-O-isopropylidene-2-O-p-toluenesulfonyl-b-D-galactopyranose |
| 1,6-ANHYDRO-3,4-O-ISOPROPYLIDENE-2-TOSYL-D-GALACTOSE |