1,2-bis(4-fluorophenyl)-2-hydroxyethanone structure
|
Common Name | 1,2-bis(4-fluorophenyl)-2-hydroxyethanone | ||
|---|---|---|---|---|
| CAS Number | 53458-16-5 | Molecular Weight | 248.22500 | |
| Density | 1.317 g/cm3 | Boiling Point | 376ºC at 760 mmHg | |
| Molecular Formula | C14H10F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.2ºC | |
| Name | 1,2-bis(4-fluorophenyl)-2-hydroxyethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.317 g/cm3 |
|---|---|
| Boiling Point | 376ºC at 760 mmHg |
| Molecular Formula | C14H10F2O2 |
| Molecular Weight | 248.22500 |
| Flash Point | 181.2ºC |
| Exact Mass | 248.06500 |
| PSA | 37.30000 |
| LogP | 2.88110 |
| Index of Refraction | 1.575 |
| InChIKey | VGZHWXAFILGMSR-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(F)cc1)C(O)c1ccc(F)cc1 |
| HS Code | 2914700090 |
|---|
| Precursor 6 | |
|---|---|
| DownStream 4 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4,4'-difluorobenzoin |
| 1,2-bis-(4-fluorophenyl)-2-hydroxyethan-1-one |
| EINECS 258-565-6 |
| 1,2-bis-[(4-fluoro)-phenyl]-2-hydroxyethanone |
| 2-hydroxy-1,2-bis(4-fluorophenyl)ethanone |
| 4,4'-fluorobenzoin |