tert-butyl N-(1-cyclopropylpiperidin-4-yl)carbamate
Modify Date: 2025-09-11 19:15:23
tert-butyl N-(1-cyclopropylpiperidin-4-yl)carbamate structure
|
Common Name | tert-butyl N-(1-cyclopropylpiperidin-4-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 534595-68-1 | Molecular Weight | 240.34200 | |
| Density | 1.06g/cm3 | Boiling Point | 339ºC at 760 mmHg | |
| Molecular Formula | C13H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.8ºC | |
| Name | tert-butyl N-(1-cyclopropylpiperidin-4-yl)carbamate |
|---|
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 339ºC at 760 mmHg |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.34200 |
| Flash Point | 158.8ºC |
| Exact Mass | 240.18400 |
| PSA | 41.57000 |
| LogP | 2.46670 |
| Index of Refraction | 1.512 |
| InChIKey | QHPWESLNMUXZMX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C2CC2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |