(r)-o-acetyl-1-[3,5-bis(trifluoromethyl)phenyl]ethanol structure
|
Common Name | (r)-o-acetyl-1-[3,5-bis(trifluoromethyl)phenyl]ethanol | ||
|---|---|---|---|---|
| CAS Number | 534613-13-3 | Molecular Weight | 300.19700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10F6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (r)-o-acetyl-1-[3,5-bis(trifluoromethyl)phenyl]ethanol |
|---|
| Molecular Formula | C12H10F6O2 |
|---|---|
| Molecular Weight | 300.19700 |
| Exact Mass | 300.05800 |
| PSA | 26.30000 |
| LogP | 4.34830 |
| InChIKey | VXLFALUFNAMMNJ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| HS Code | 2915390090 |
|---|
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |