N,N-di(butan-2-yl)heptanamide structure
|
Common Name | N,N-di(butan-2-yl)heptanamide | ||
|---|---|---|---|---|
| CAS Number | 53463-20-0 | Molecular Weight | 241.41300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H31NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-di(butan-2-yl)heptanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H31NO |
|---|---|
| Molecular Weight | 241.41300 |
| Exact Mass | 241.24100 |
| PSA | 20.31000 |
| LogP | 4.38240 |
| InChIKey | LEPQLARCLKOINL-UHFFFAOYSA-N |
| SMILES | CCCCCCC(=O)N(C(C)CC)C(C)CC |
| HS Code | 2924199090 |
|---|
|
~97%
N,N-di(butan-2-... CAS#:53463-20-0 |
| Literature: Al-Jallo; Hussain; Mansoor; Sameh; Al-Saidi Journal of Chemical and Engineering Data, 1984 , vol. 29, # 4 p. 479 - 481 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N-DI(SEC-BUTYL)HEPTANAMIDE |
| N,N-bis(methylpropyl)heptanamide |