3-[(2-chlorophenyl)methyl]benzothiazol-2-one structure
|
Common Name | 3-[(2-chlorophenyl)methyl]benzothiazol-2-one | ||
|---|---|---|---|---|
| CAS Number | 5347-04-6 | Molecular Weight | 245.27400 | |
| Density | 1.408g/cm3 | Boiling Point | 443.9ºC at 760 mmHg | |
| Molecular Formula | C14H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.3ºC | |
| Name | 4,4-diethyl-1-phenylpyrrolidine-2,3,5-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.408g/cm3 |
|---|---|
| Boiling Point | 443.9ºC at 760 mmHg |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.27400 |
| Flash Point | 222.3ºC |
| Exact Mass | 245.10500 |
| PSA | 54.45000 |
| LogP | 2.00030 |
| Index of Refraction | 1.693 |
| InChIKey | VSEHJVDPYBDZIH-UHFFFAOYSA-N |
| SMILES | CCC1(CC)C(=O)C(=O)N(c2ccccc2)C1=O |
| HS Code | 2933990090 |
|---|
|
~%
3-[(2-chlorophe... CAS#:5347-04-6 |
| Literature: Skinner; Ludwig Journal of the American Chemical Society, 1956 , vol. 78, p. 4656,4657 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,4-diethyl-1-phenyl-pyrrolidine-2,3,5-trione |
| 3,3-Diethyl-1-phenyl-pyrrolidin-2,4,5-trion |
| 4,4-Diaethyl-1-phenyl-pyrrolidin-2,3,5-trion |